CAS 1346687-15-7
:5-(3-Thienyl)-3-pyridinemethanamine
Description:
5-(3-Thienyl)-3-pyridinemethanamine is an organic compound characterized by its unique structure, which includes a pyridine ring and a thienyl group. The presence of these heterocycles contributes to its potential biological activity and makes it of interest in medicinal chemistry. The compound typically exhibits properties such as moderate solubility in polar solvents and may have specific interactions with biological targets due to its amine functional group. Its molecular structure suggests potential for hydrogen bonding and π-π stacking interactions, which can influence its reactivity and binding affinity in biological systems. Additionally, the thienyl group can impart distinct electronic properties, potentially affecting the compound's pharmacokinetics and pharmacodynamics. As with many heterocyclic compounds, the synthesis and characterization of 5-(3-Thienyl)-3-pyridinemethanamine are crucial for understanding its applications in drug development and other chemical processes. Further studies would be necessary to elucidate its specific biological activities and potential therapeutic uses.
Formula:C10H10N2S
InChI:InChI=1S/C10H10N2S/c11-4-8-3-10(6-12-5-8)9-1-2-13-7-9/h1-3,5-7H,4,11H2
InChI key:InChIKey=NFDCSADFHCSLRX-UHFFFAOYSA-N
SMILES:C(N)C1=CC(=CN=C1)C=2C=CSC2
Synonyms:- 3-Pyridinemethanamine, 5-(3-thienyl)-
- 5-(3-Thienyl)-3-pyridinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
