CAS 1346687-18-0
:5-(3-Furanyl)-3-pyridinecarboxamide
Description:
5-(3-Furanyl)-3-pyridinecarboxamide is an organic compound characterized by its unique structural features, which include a pyridine ring and a furan moiety. The presence of the carboxamide functional group contributes to its potential as a bioactive molecule. This compound is typically classified as a heterocyclic aromatic compound due to the incorporation of nitrogen and oxygen in its rings, which can influence its chemical reactivity and solubility. It may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. The compound's molecular interactions can be influenced by factors such as hydrogen bonding and π-π stacking due to its aromatic nature. Additionally, its stability and reactivity can be affected by environmental conditions, such as pH and temperature. Overall, 5-(3-Furanyl)-3-pyridinecarboxamide represents a class of compounds that may have applications in pharmaceuticals, agrochemicals, or materials science, depending on its specific properties and interactions.
Formula:C10H8N2O2
InChI:InChI=1S/C10H8N2O2/c11-10(13)9-3-8(4-12-5-9)7-1-2-14-6-7/h1-6H,(H2,11,13)
InChI key:InChIKey=ASKILBXKYOIRJN-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=CC(=CN=C1)C=2C=COC2
Synonyms:- 5-(3-Furanyl)-3-pyridinecarboxamide
- 3-Pyridinecarboxamide, 5-(3-furanyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
