
CAS 1346687-21-5
:5-(3-Furanyl)-3-pyridinecarboxaldehyde
Description:
5-(3-Furanyl)-3-pyridinecarboxaldehyde is an organic compound characterized by the presence of both a furan and a pyridine ring, which contribute to its unique chemical properties. The furan moiety is a five-membered aromatic ring containing oxygen, while the pyridine ring is a six-membered aromatic ring with one nitrogen atom. This compound features an aldehyde functional group (-CHO) attached to the pyridine ring, which enhances its reactivity, particularly in nucleophilic addition reactions. The presence of these heteroatoms in the rings can influence the compound's polarity, solubility, and potential interactions with biological systems. It may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry. Additionally, its synthesis and characterization can involve various organic reactions, including condensation and functional group transformations. Overall, 5-(3-Furanyl)-3-pyridinecarboxaldehyde represents a versatile scaffold for further chemical modifications and applications in research and development.
Formula:C10H7NO2
InChI:InChI=1S/C10H7NO2/c12-6-8-3-10(5-11-4-8)9-1-2-13-7-9/h1-7H
InChI key:InChIKey=IWQGVFXKAQXXEE-UHFFFAOYSA-N
SMILES:C(=O)C1=CC(=CN=C1)C=2C=COC2
Synonyms:- 5-(3-Furanyl)-3-pyridinecarboxaldehyde
- 3-Pyridinecarboxaldehyde, 5-(3-furanyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
