CAS 1346687-24-8
:5-(2-Pyrazinyl)-3-pyridinecarboxamide
Description:
5-(2-Pyrazinyl)-3-pyridinecarboxamide, identified by its CAS number 1346687-24-8, is a chemical compound that features a fused heterocyclic structure, incorporating both pyrazine and pyridine rings. This compound is characterized by its amide functional group, which contributes to its potential biological activity and solubility properties. The presence of nitrogen atoms in both the pyrazine and pyridine rings enhances its ability to participate in hydrogen bonding and coordination with metal ions, making it of interest in medicinal chemistry and material science. Typically, compounds of this nature may exhibit various pharmacological activities, including antimicrobial or anticancer properties, although specific biological data would depend on empirical studies. Additionally, its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. The compound's stability, reactivity, and solubility can be influenced by the substituents on the aromatic rings, which can be further explored in synthetic and analytical chemistry contexts.
Formula:C10H8N4O
InChI:InChI=1S/C10H8N4O/c11-10(15)8-3-7(4-13-5-8)9-6-12-1-2-14-9/h1-6H,(H2,11,15)
InChI key:InChIKey=WRWIEJKABCCWAU-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=CC(=CN=C1)C=2C=NC=CN2
Synonyms:- 5-(2-Pyrazinyl)-3-pyridinecarboxamide
- 3-Pyridinecarboxamide, 5-(2-pyrazinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
