CAS 1346687-26-0
:5-(2-Pyrazinyl)-3-pyridinemethanol
Description:
5-(2-Pyrazinyl)-3-pyridinemethanol is a chemical compound characterized by its unique structure, which includes a pyridine and a pyrazine ring. This compound features a hydroxymethyl group attached to the pyridine moiety, contributing to its potential reactivity and solubility in various solvents. The presence of both nitrogen-containing heterocycles in its structure suggests that it may exhibit interesting biological activities, potentially serving as a scaffold for drug development. Its molecular formula and specific functional groups may influence its interactions with biological targets, making it a candidate for further pharmacological studies. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would be influenced by the arrangement of its atoms and the presence of polar functional groups. As with many heterocyclic compounds, it may also exhibit unique spectroscopic characteristics, making it identifiable through techniques such as NMR and mass spectrometry. Overall, 5-(2-Pyrazinyl)-3-pyridinemethanol represents a class of compounds with significant potential in medicinal chemistry and material science.
Formula:C10H9N3O
InChI:InChI=1S/C10H9N3O/c14-7-8-3-9(5-12-4-8)10-6-11-1-2-13-10/h1-6,14H,7H2
InChI key:InChIKey=IESBGKQCOOEDCI-UHFFFAOYSA-N
SMILES:C(O)C1=CC(=CN=C1)C=2C=NC=CN2
Synonyms:- 3-Pyridinemethanol, 5-(2-pyrazinyl)-
- 5-(2-Pyrazinyl)-3-pyridinemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
