CAS 1346687-28-2
:5-(2-Pyrazinyl)-3-pyridinemethanamine
Description:
5-(2-Pyrazinyl)-3-pyridinemethanamine is an organic compound characterized by its heterocyclic structure, which includes both pyrazine and pyridine rings. This compound features an amine functional group, contributing to its potential as a building block in medicinal chemistry and drug development. The presence of nitrogen atoms in the rings enhances its reactivity and solubility in polar solvents, making it suitable for various chemical reactions. Its molecular structure suggests potential biological activity, which may include interactions with specific receptors or enzymes, making it of interest in pharmacological research. The compound's properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity. Additionally, its CAS number, 1346687-28-2, allows for easy identification and reference in chemical databases. Overall, 5-(2-Pyrazinyl)-3-pyridinemethanamine represents a versatile compound with potential applications in the fields of organic synthesis and medicinal chemistry.
Formula:C10H10N4
InChI:InChI=1S/C10H10N4/c11-4-8-3-9(6-13-5-8)10-7-12-1-2-14-10/h1-3,5-7H,4,11H2
InChI key:InChIKey=JNOSJTXASARJEP-UHFFFAOYSA-N
SMILES:C(N)C1=CC(=CN=C1)C=2C=NC=CN2
Synonyms:- 3-Pyridinemethanamine, 5-(2-pyrazinyl)-
- 5-(2-Pyrazinyl)-3-pyridinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
