
CAS 1346687-31-7
:5-(2-Pyrimidinyl)-3-pyridinecarboxaldehyde
Description:
5-(2-Pyrimidinyl)-3-pyridinecarboxaldehyde is an organic compound characterized by its heterocyclic structure, which includes both pyridine and pyrimidine rings. This compound features an aldehyde functional group, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of nitrogen atoms in the aromatic rings enhances its ability to participate in various chemical reactions, such as nucleophilic additions and condensation reactions. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its unique structure allows for potential interactions with biological targets, making it of interest in drug discovery and development. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can be influenced by factors like substituents and the presence of functional groups. Overall, 5-(2-Pyrimidinyl)-3-pyridinecarboxaldehyde represents a valuable scaffold in the field of organic chemistry and pharmaceuticals.
Formula:C10H7N3O
InChI:InChI=1S/C10H7N3O/c14-7-8-4-9(6-11-5-8)10-12-2-1-3-13-10/h1-7H
InChI key:InChIKey=YEQVGHPSRLNFSC-UHFFFAOYSA-N
SMILES:C(=O)C1=CC(=CN=C1)C=2N=CC=CN2
Synonyms:- 3-Pyridinecarboxaldehyde, 5-(2-pyrimidinyl)-
- 5-(2-Pyrimidinyl)-3-pyridinecarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
