CAS 1346687-33-9
:5-(5-Pyrimidinyl)-3-pyridinecarboxamide
Description:
5-(5-Pyrimidinyl)-3-pyridinecarboxamide, identified by its CAS number 1346687-33-9, is a chemical compound that features a pyrimidine ring and a pyridine ring, both of which are nitrogen-containing heterocycles. This compound is characterized by its amide functional group, which contributes to its potential solubility in polar solvents and its ability to participate in hydrogen bonding. The presence of multiple nitrogen atoms in its structure may influence its biological activity, making it of interest in pharmaceutical research, particularly in the development of compounds with potential therapeutic applications. The molecular structure suggests that it may exhibit properties such as moderate lipophilicity and the ability to interact with biological targets, which could be relevant in drug design. Additionally, its stability and reactivity can be influenced by the electronic effects of the nitrogen atoms and the overall arrangement of the rings. As with many heterocyclic compounds, its synthesis and characterization would typically involve techniques such as NMR spectroscopy, mass spectrometry, and crystallography to confirm its structure and purity.
Formula:C10H8N4O
InChI:InChI=1S/C10H8N4O/c11-10(15)8-1-7(2-12-3-8)9-4-13-6-14-5-9/h1-6H,(H2,11,15)
InChI key:InChIKey=OJMZSONUQWESMK-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=CC(=CN=C1)C=2C=NC=NC2
Synonyms:- 3-Pyridinecarboxamide, 5-(5-pyrimidinyl)-
- 5-(5-Pyrimidinyl)-3-pyridinecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
