CAS 1346687-35-1
:5-(5-Pyrimidinyl)-3-pyridinecarboxaldehyde
Description:
5-(5-Pyrimidinyl)-3-pyridinecarboxaldehyde is an organic compound characterized by its heterocyclic structure, which includes both pyridine and pyrimidine rings. This compound features an aldehyde functional group, which is indicative of its reactivity and potential applications in organic synthesis. The presence of nitrogen atoms in the pyridine and pyrimidine rings contributes to its unique chemical properties, such as the ability to participate in hydrogen bonding and coordination with metal ions. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to its functional groups. Its structural features suggest potential uses in medicinal chemistry, particularly in the development of pharmaceuticals, as well as in agrochemicals. Additionally, the compound may serve as a building block for more complex molecules in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C10H7N3O
InChI:InChI=1S/C10H7N3O/c14-6-8-1-9(3-11-2-8)10-4-12-7-13-5-10/h1-7H
InChI key:InChIKey=BWMUOEOLCYSPCF-UHFFFAOYSA-N
SMILES:C(=O)C1=CC(=CN=C1)C=2C=NC=NC2
Synonyms:- 5-(5-Pyrimidinyl)-3-pyridinecarboxaldehyde
- 3-Pyridinecarboxaldehyde, 5-(5-pyrimidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
