CymitQuimica logo

CAS 1346687-37-3

:

5-(3-Pyridazinyl)-3-pyridinecarboxylic acid

Description:
5-(3-Pyridazinyl)-3-pyridinecarboxylic acid is a heterocyclic organic compound characterized by the presence of both pyridine and pyridazine rings in its structure. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The dual nitrogen-containing aromatic rings enhance its ability to participate in various chemical reactions, making it a candidate for applications in medicinal chemistry and material science. The presence of multiple nitrogen atoms can also influence its solubility and interaction with biological systems. Additionally, the compound may exhibit specific pharmacological properties, which could be explored in drug development. Its molecular structure allows for potential hydrogen bonding and coordination with metal ions, further expanding its utility in coordination chemistry. Overall, 5-(3-Pyridazinyl)-3-pyridinecarboxylic acid is a versatile compound with interesting chemical properties that warrant further investigation for various applications.
Formula:C10H7N3O2
InChI:InChI=1S/C10H7N3O2/c14-10(15)8-4-7(5-11-6-8)9-2-1-3-12-13-9/h1-6H,(H,14,15)
InChI key:InChIKey=ZKLHJORKGFXCEB-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(=CN=C1)C2=CC=CN=N2
Synonyms:
  • 5-(3-Pyridazinyl)-3-pyridinecarboxylic acid
  • 3-Pyridinecarboxylic acid, 5-(3-pyridazinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.