
CAS 1346687-38-4
:Methyl 5-(3-pyridazinyl)-3-pyridinecarboxylate
Description:
Methyl 5-(3-pyridazinyl)-3-pyridinecarboxylate is a chemical compound characterized by its pyridine and pyridazine moieties, which contribute to its aromatic properties and potential biological activity. The structure features a methyl ester functional group, enhancing its solubility in organic solvents and influencing its reactivity. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its molecular framework suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of nitrogen-containing heterocycles that can interact with biological targets. The compound's properties, such as melting point, boiling point, and solubility, can vary based on purity and environmental conditions. Additionally, it may undergo various chemical reactions, including esterification and nucleophilic substitutions, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C11H9N3O2
InChI:InChI=1S/C11H9N3O2/c1-16-11(15)9-5-8(6-12-7-9)10-3-2-4-13-14-10/h2-7H,1H3
InChI key:InChIKey=NXXXMZMHNHBTGD-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC(=CN=C1)C2=CC=CN=N2
Synonyms:- 3-Pyridinecarboxylic acid, 5-(3-pyridazinyl)-, methyl ester
- Methyl 5-(3-pyridazinyl)-3-pyridinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
