CymitQuimica logo

CAS 1346687-40-8

:

5-(3-Pyridazinyl)-3-pyridinecarboxamide

Description:
5-(3-Pyridazinyl)-3-pyridinecarboxamide, identified by its CAS number 1346687-40-8, is a chemical compound characterized by its heterocyclic structure, which includes both pyridine and pyridazine rings. This compound typically exhibits properties associated with aromatic amides, such as potential solubility in polar solvents and moderate stability under standard conditions. The presence of nitrogen atoms in the rings contributes to its basicity and may influence its reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The specific interactions and applications can vary widely depending on the functional groups present and the overall molecular conformation. As with many heterocyclic compounds, the study of its properties can provide insights into its potential uses in pharmaceuticals, agrochemicals, or materials science.
Formula:C10H8N4O
InChI:InChI=1S/C10H8N4O/c11-10(15)8-4-7(5-12-6-8)9-2-1-3-13-14-9/h1-6H,(H2,11,15)
InChI key:InChIKey=TZLYPVZQNRLGCC-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=CC(=CN=C1)C2=CC=CN=N2
Synonyms:
  • 5-(3-Pyridazinyl)-3-pyridinecarboxamide
  • 3-Pyridinecarboxamide, 5-(3-pyridazinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.