CAS 1346687-41-9
:5-(3-Pyridazinyl)-3-pyridinecarbonitrile
Description:
5-(3-Pyridazinyl)-3-pyridinecarbonitrile is a chemical compound characterized by its unique structure, which includes a pyridazine ring and a pyridine ring, both of which are nitrogen-containing heterocycles. This compound features a carbonitrile functional group, which contributes to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of multiple nitrogen atoms in its structure may influence its electronic properties, making it a candidate for coordination with metal ions or participation in various chemical reactions. Additionally, the compound's molecular geometry and functional groups can affect its solubility, stability, and interaction with biological systems. As a result, 5-(3-Pyridazinyl)-3-pyridinecarbonitrile may exhibit interesting biological activities, warranting further investigation for potential therapeutic uses. Its specific characteristics, such as melting point, boiling point, and spectral data, would typically be determined through experimental methods and are essential for understanding its behavior in different environments.
Formula:C10H6N4
InChI:InChI=1S/C10H6N4/c11-5-8-4-9(7-12-6-8)10-2-1-3-13-14-10/h1-4,6-7H
InChI key:InChIKey=JKGMIPNXZKEADD-UHFFFAOYSA-N
SMILES:C(#N)C1=CC(=CN=C1)C2=CC=CN=N2
Synonyms:- 5-(3-Pyridazinyl)-3-pyridinecarbonitrile
- 3-Pyridinecarbonitrile, 5-(3-pyridazinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
