CAS 1346687-45-3
:5-(4-Pyridazinyl)-3-pyridinecarboxylic acid
Description:
5-(4-Pyridazinyl)-3-pyridinecarboxylic acid, identified by its CAS number 1346687-45-3, is a heterocyclic organic compound featuring both pyridine and pyridazine rings. This compound typically exhibits characteristics common to aromatic carboxylic acids, including the presence of a carboxyl functional group (-COOH) that contributes to its acidity and potential for forming hydrogen bonds. The pyridazine and pyridine moieties enhance its chemical reactivity and may influence its solubility in various solvents, often making it soluble in polar organic solvents. The compound may also exhibit biological activity, making it of interest in pharmaceutical research. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Additionally, the presence of nitrogen atoms in the aromatic rings can affect its electronic properties, potentially leading to unique interactions in biological systems. Overall, 5-(4-Pyridazinyl)-3-pyridinecarboxylic acid is a compound of interest due to its structural complexity and potential applications in various fields of chemistry and biology.
Formula:C10H7N3O2
InChI:InChI=1S/C10H7N3O2/c14-10(15)9-3-8(4-11-5-9)7-1-2-12-13-6-7/h1-6H,(H,14,15)
InChI key:InChIKey=HDGGEPTYPLDYGS-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(=CN=C1)C=2C=CN=NC2
Synonyms:- 5-(4-Pyridazinyl)-3-pyridinecarboxylic acid
- 3-Pyridinecarboxylic acid, 5-(4-pyridazinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
