CAS 1346687-46-4
:Methyl 5-(4-pyridazinyl)-3-pyridinecarboxylate
Description:
Methyl 5-(4-pyridazinyl)-3-pyridinecarboxylate is a chemical compound characterized by its pyridine and pyridazine moieties, which contribute to its aromatic properties and potential biological activity. The structure features a methyl ester functional group, which enhances its solubility in organic solvents and may influence its reactivity. This compound is likely to exhibit polar characteristics due to the presence of nitrogen atoms in the heterocyclic rings, which can participate in hydrogen bonding. Methyl 5-(4-pyridazinyl)-3-pyridinecarboxylate may be of interest in medicinal chemistry, particularly for its potential pharmacological properties, as compounds containing pyridine and pyridazine rings are often associated with various biological activities. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. Safety data and handling precautions should be observed, as with any chemical substance, to ensure safe laboratory practices.
Formula:C11H9N3O2
InChI:InChI=1S/C11H9N3O2/c1-16-11(15)10-4-9(5-12-6-10)8-2-3-13-14-7-8/h2-7H,1H3
InChI key:InChIKey=XDFMOHIAMCBYHR-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC(=CN=C1)C=2C=CN=NC2
Synonyms:- Methyl 5-(4-pyridazinyl)-3-pyridinecarboxylate
- 3-Pyridinecarboxylic acid, 5-(4-pyridazinyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
