CymitQuimica logo

CAS 1346687-47-5

:

5-(4-Pyridazinyl)-3-pyridinecarboxamide

Description:
5-(4-Pyridazinyl)-3-pyridinecarboxamide is a chemical compound characterized by its heterocyclic structure, which includes both pyridine and pyridazine rings. This compound typically exhibits properties associated with aromatic amides, such as moderate solubility in polar solvents and potential for hydrogen bonding due to the presence of the amide functional group. The presence of multiple nitrogen atoms in its structure may contribute to its ability to engage in various interactions, including coordination with metal ions or participation in biological processes. It may also display biological activity, making it of interest in pharmaceutical research. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Its specific reactivity and stability can be influenced by substituents on the aromatic rings, which may affect its pharmacokinetic properties. Overall, 5-(4-Pyridazinyl)-3-pyridinecarboxamide represents a class of compounds that could be valuable in both synthetic and applied chemistry contexts.
Formula:C10H8N4O
InChI:InChI=1S/C10H8N4O/c11-10(15)9-3-8(4-12-5-9)7-1-2-13-14-6-7/h1-6H,(H2,11,15)
InChI key:InChIKey=JULSOIAHWUKJOW-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=CC(=CN=C1)C=2C=CN=NC2
Synonyms:
  • 3-Pyridinecarboxamide, 5-(4-pyridazinyl)-
  • 5-(4-Pyridazinyl)-3-pyridinecarboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.