CAS 1346687-49-7
:5-(4-Pyridazinyl)-3-pyridinemethanol
Description:
5-(4-Pyridazinyl)-3-pyridinemethanol is a chemical compound characterized by its dual pyridine and pyridazine ring structure, which contributes to its potential biological activity. The presence of hydroxymethyl functionality at the 3-position of the pyridine ring enhances its solubility and reactivity, making it a candidate for various chemical reactions and applications in medicinal chemistry. This compound may exhibit properties such as antimicrobial, anti-inflammatory, or antitumor activities, although specific biological effects would depend on further empirical studies. Its molecular structure allows for potential interactions with biological targets, which is of interest in drug design. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. As with many heterocyclic compounds, the synthesis and characterization of 5-(4-Pyridazinyl)-3-pyridinemethanol are crucial for understanding its properties and potential applications in pharmaceuticals or agrochemicals. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use.
Formula:C10H9N3O
InChI:InChI=1S/C10H9N3O/c14-7-8-3-10(5-11-4-8)9-1-2-12-13-6-9/h1-6,14H,7H2
InChI key:InChIKey=NAGUNGPNTFQBBR-UHFFFAOYSA-N
SMILES:C(O)C1=CC(=CN=C1)C=2C=CN=NC2
Synonyms:- 5-(4-Pyridazinyl)-3-pyridinemethanol
- 3-Pyridinemethanol, 5-(4-pyridazinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
