CymitQuimica logo

CAS 1346687-59-9

:

5-(1,3,4-Thiadiazol-2-yl)-3-pyridinecarboxylic acid

Description:
5-(1,3,4-Thiadiazol-2-yl)-3-pyridinecarboxylic acid is a heterocyclic compound characterized by the presence of both a pyridine and a thiadiazole ring in its structure. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The thiadiazole moiety is known for its biological activity, often exhibiting antimicrobial and antifungal properties, while the pyridine ring can enhance solubility and interaction with biological targets. The presence of these functional groups suggests that this compound may participate in various chemical reactions, including esterification and amidation. Additionally, its unique structure may allow for specific interactions with enzymes or receptors, making it of interest in pharmaceutical research. The compound's solubility, stability, and reactivity can be influenced by factors such as pH and the presence of other solvents or reagents. Overall, 5-(1,3,4-Thiadiazol-2-yl)-3-pyridinecarboxylic acid represents a versatile chemical entity with potential applications in medicinal chemistry and material science.
Formula:C8H5N3O2S
InChI:InChI=1S/C8H5N3O2S/c12-8(13)6-1-5(2-9-3-6)7-11-10-4-14-7/h1-4H,(H,12,13)
InChI key:InChIKey=NMSUAJZKXMBXOB-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(=CN=C1)C2=NN=CS2
Synonyms:
  • 5-(1,3,4-Thiadiazol-2-yl)-3-pyridinecarboxylic acid
  • 3-Pyridinecarboxylic acid, 5-(1,3,4-thiadiazol-2-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.