CAS 1346687-60-2
:Methyl 5-(1,3,4-thiadiazol-2-yl)-3-pyridinecarboxylate
Description:
Methyl 5-(1,3,4-thiadiazol-2-yl)-3-pyridinecarboxylate is a chemical compound characterized by its unique structure, which includes a pyridine ring and a thiadiazole moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the thiadiazole group may impart specific pharmacological properties, making it of interest in medicinal chemistry. The methyl ester functional group suggests that it can undergo hydrolysis to yield the corresponding carboxylic acid, which may further influence its reactivity and interactions. Additionally, the compound's molecular structure may allow for various substitution reactions, enhancing its versatility in synthetic applications. Overall, Methyl 5-(1,3,4-thiadiazol-2-yl)-3-pyridinecarboxylate is a compound of interest for research in fields such as drug development and agrochemicals, owing to its potential bioactivity and chemical reactivity.
Formula:C9H7N3O2S
InChI:InChI=1S/C9H7N3O2S/c1-14-9(13)7-2-6(3-10-4-7)8-12-11-5-15-8/h2-5H,1H3
InChI key:InChIKey=NLYVZFWKJSEQBI-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC(=CN=C1)C2=NN=CS2
Synonyms:- 3-Pyridinecarboxylic acid, 5-(1,3,4-thiadiazol-2-yl)-, methyl ester
- Methyl 5-(1,3,4-thiadiazol-2-yl)-3-pyridinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
