CymitQuimica logo

CAS 1346687-64-6

:

5-(1,3,4-Thiadiazol-2-yl)-3-pyridinecarboxaldehyde

Description:
5-(1,3,4-Thiadiazol-2-yl)-3-pyridinecarboxaldehyde is a heterocyclic compound characterized by the presence of both a pyridine and a thiadiazole ring in its structure. This compound features a carboxaldehyde functional group, which contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The thiadiazole moiety is known for its biological activity, often exhibiting antimicrobial and antifungal properties, while the pyridine ring can enhance the compound's ability to interact with biological targets due to its nitrogen atom. The presence of the aldehyde group allows for further functionalization, making it a versatile intermediate in the synthesis of more complex molecules. Additionally, this compound may exhibit unique physical properties, such as solubility in various organic solvents, which can be influenced by the substituents on the rings. Overall, 5-(1,3,4-Thiadiazol-2-yl)-3-pyridinecarboxaldehyde is of interest in research fields focused on drug development and materials science.
Formula:C8H5N3OS
InChI:InChI=1S/C8H5N3OS/c12-4-6-1-7(3-9-2-6)8-11-10-5-13-8/h1-5H
InChI key:InChIKey=ONGUGFKXZFENJU-UHFFFAOYSA-N
SMILES:C(=O)C1=CC(=CN=C1)C2=NN=CS2
Synonyms:
  • 5-(1,3,4-Thiadiazol-2-yl)-3-pyridinecarboxaldehyde
  • 3-Pyridinecarboxaldehyde, 5-(1,3,4-thiadiazol-2-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.