CymitQuimica logo

CAS 1346691-21-1

:

3-Chloro-5-(1-methylbutoxy)pyridazine

Description:
3-Chloro-5-(1-methylbutoxy)pyridazine is an organic compound characterized by its pyridazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a chlorine atom at the 3-position and a 1-methylbutoxy group at the 5-position contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the electronegative chlorine and the ether functional group from the butoxy moiety. Its structure suggests potential applications in pharmaceuticals or agrochemicals, as similar compounds often exhibit biological activity. The presence of the butoxy group may enhance solubility in organic solvents, while the chlorinated pyridazine framework can influence reactivity and stability. Additionally, the compound's synthesis may involve standard organic reactions such as nucleophilic substitution or coupling reactions. Safety data and handling precautions should be considered, as halogenated compounds can pose environmental and health risks. Overall, 3-Chloro-5-(1-methylbutoxy)pyridazine represents a versatile structure in organic chemistry with potential applications in various fields.
Formula:C9H13ClN2O
InChI:InChI=1S/C9H13ClN2O/c1-3-4-7(2)13-8-5-9(10)12-11-6-8/h5-7H,3-4H2,1-2H3
InChI key:InChIKey=KUWCLSJTMJSJFC-UHFFFAOYSA-N
SMILES:O(C(CCC)C)C=1C=C(Cl)N=NC1
Synonyms:
  • 3-Chloro-5-(1-methylbutoxy)pyridazine
  • Pyridazine, 3-chloro-5-(1-methylbutoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.