CymitQuimica logo

CAS 1346691-23-3

:

3-Chloro-5-(1-ethylpropoxy)pyridazine

Description:
3-Chloro-5-(1-ethylpropoxy)pyridazine is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two adjacent nitrogen atoms. The presence of a chlorine atom at the 3-position and an ethylpropoxy group at the 5-position contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the presence of the ether functional group in the ethylpropoxy moiety, which can influence its solubility in various solvents. The chlorine substituent may enhance its reactivity, making it a potential candidate for further chemical transformations. Additionally, the structure suggests potential applications in pharmaceuticals or agrochemicals, where pyridazine derivatives are often explored for their biological activity. Safety and handling precautions should be observed, as halogenated compounds can pose health risks. Overall, 3-Chloro-5-(1-ethylpropoxy)pyridazine represents a specific class of heterocyclic compounds with diverse applications in chemical synthesis and research.
Formula:C9H13ClN2O
InChI:InChI=1S/C9H13ClN2O/c1-3-7(4-2)13-8-5-9(10)12-11-6-8/h5-7H,3-4H2,1-2H3
InChI key:InChIKey=DQZIFRHFDDTLBL-UHFFFAOYSA-N
SMILES:O(C(CC)CC)C=1C=C(Cl)N=NC1
Synonyms:
  • 3-Chloro-5-(1-ethylpropoxy)pyridazine
  • Pyridazine, 3-chloro-5-(1-ethylpropoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.