CymitQuimica logo

CAS 1346691-24-4

:

3-Chloro-5-(cyclopropyloxy)pyridazine

Description:
3-Chloro-5-(cyclopropyloxy)pyridazine is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 2. The presence of a chlorine atom at the 3-position and a cyclopropyloxy group at the 5-position contributes to its unique reactivity and potential applications. This compound may exhibit properties typical of halogenated heterocycles, such as increased lipophilicity and potential biological activity. The cyclopropyloxy substituent can influence the compound's steric and electronic properties, potentially affecting its interactions with biological targets. As with many pyridazine derivatives, it may be of interest in medicinal chemistry for its potential pharmacological activities. Safety and handling considerations should be taken into account, as halogenated compounds can pose environmental and health risks. Overall, 3-Chloro-5-(cyclopropyloxy)pyridazine represents a class of compounds that may have significant implications in chemical research and development.
Formula:C7H7ClN2O
InChI:InChI=1S/C7H7ClN2O/c8-7-3-6(4-9-10-7)11-5-1-2-5/h3-5H,1-2H2
InChI key:InChIKey=MICAJNQOTQGIQI-UHFFFAOYSA-N
SMILES:O(C1CC1)C=2C=C(Cl)N=NC2
Synonyms:
  • Pyridazine, 3-chloro-5-(cyclopropyloxy)-
  • 3-Chloro-5-(cyclopropyloxy)pyridazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.