
CAS 1346691-25-5
:3-Chloro-5-(cyclobutyloxy)pyridazine
Description:
3-Chloro-5-(cyclobutyloxy)pyridazine is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two adjacent nitrogen atoms. The presence of a chlorine atom at the 3-position and a cyclobutyloxy group at the 5-position contributes to its unique reactivity and potential applications in various fields, including medicinal chemistry and agrochemicals. The cyclobutyloxy group introduces a cyclic ether functionality, which can influence the compound's solubility and interaction with biological targets. This compound may exhibit specific biological activities due to its structural features, making it of interest for research in drug development. Additionally, the presence of halogen substituents often enhances the lipophilicity and metabolic stability of organic molecules. As with many pyridazine derivatives, the compound's properties, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the nature of the substituents. Safety and handling precautions should be observed, as with all chemical substances, particularly those with halogenated groups.
Formula:C8H9ClN2O
InChI:InChI=1S/C8H9ClN2O/c9-8-4-7(5-10-11-8)12-6-2-1-3-6/h4-6H,1-3H2
InChI key:InChIKey=KEXDHBLFFFPSJY-UHFFFAOYSA-N
SMILES:O(C=1C=C(Cl)N=NC1)C2CCC2
Synonyms:- 3-Chloro-5-(cyclobutyloxy)pyridazine
- Pyridazine, 3-chloro-5-(cyclobutyloxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
