CAS 1346691-26-6
:3-Chloro-5-(cyclopentyloxy)pyridazine
Description:
3-Chloro-5-(cyclopentyloxy)pyridazine is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 2. The presence of a chlorine atom at the 3-position and a cyclopentyloxy group at the 5-position contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the electronegative chlorine atom and the oxygen in the cyclopentyloxy group, influencing its solubility in various solvents. The cyclopentyl group can impart hydrophobic characteristics, affecting the compound's interactions with biological systems. Additionally, the structure suggests potential reactivity in nucleophilic substitution reactions, particularly at the chlorine site. The compound may have applications in medicinal chemistry or as an intermediate in organic synthesis, although specific biological activities or uses would depend on further research. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper laboratory practices.
Formula:C9H11ClN2O
InChI:InChI=1S/C9H11ClN2O/c10-9-5-8(6-11-12-9)13-7-3-1-2-4-7/h5-7H,1-4H2
InChI key:InChIKey=AVIQPKSZORJLKI-UHFFFAOYSA-N
SMILES:O(C=1C=C(Cl)N=NC1)C2CCCC2
Synonyms:- 3-Chloro-5-(cyclopentyloxy)pyridazine
- Pyridazine, 3-chloro-5-(cyclopentyloxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
