
CAS 1346691-27-7
:3-Chloro-5-(cyclohexyloxy)pyridazine
Description:
3-Chloro-5-(cyclohexyloxy)pyridazine is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of a chlorine atom at the 3-position and a cyclohexyloxy group at the 5-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyridazine moiety, which is known for its biological activity. The cyclohexyloxy group may enhance lipophilicity, influencing the compound's interaction with biological membranes. Additionally, the chlorine substituent can affect the compound's reactivity and stability. As with many chemical substances, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, 3-Chloro-5-(cyclohexyloxy)pyridazine represents a compound of interest in various chemical research fields.
Formula:C10H13ClN2O
InChI:InChI=1S/C10H13ClN2O/c11-10-6-9(7-12-13-10)14-8-4-2-1-3-5-8/h6-8H,1-5H2
InChI key:InChIKey=XWNHWEHSIXMVJB-UHFFFAOYSA-N
SMILES:O(C=1C=C(Cl)N=NC1)C2CCCCC2
Synonyms:- Pyridazine, 3-chloro-5-(cyclohexyloxy)-
- 3-Chloro-5-(cyclohexyloxy)pyridazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
