CymitQuimica logo

CAS 1346691-30-2

:

3-Chloro-5-(cyclopentylmethoxy)pyridazine

Description:
3-Chloro-5-(cyclopentylmethoxy)pyridazine is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two adjacent nitrogen atoms. The presence of a chlorine atom at the 3-position and a cyclopentylmethoxy group at the 5-position contributes to its unique chemical properties. This compound may exhibit moderate to high lipophilicity due to the cyclopentyl group, which can influence its solubility and biological activity. The methoxy group can enhance the compound's reactivity and stability, potentially making it a candidate for various applications in medicinal chemistry or agrochemicals. Additionally, the chlorinated pyridazine structure may impart specific electronic properties, affecting its interaction with biological targets. As with many pyridazine derivatives, it may possess interesting pharmacological activities, although specific biological data would be necessary to ascertain its efficacy and safety profile. Overall, 3-Chloro-5-(cyclopentylmethoxy)pyridazine represents a structurally diverse compound with potential utility in various chemical and pharmaceutical contexts.
Formula:C10H13ClN2O
InChI:InChI=1S/C10H13ClN2O/c11-10-5-9(6-12-13-10)14-7-8-3-1-2-4-8/h5-6,8H,1-4,7H2
InChI key:InChIKey=MSLYPOPMRFAXAD-UHFFFAOYSA-N
SMILES:O(CC1CCCC1)C=2C=C(Cl)N=NC2
Synonyms:
  • 3-Chloro-5-(cyclopentylmethoxy)pyridazine
  • Pyridazine, 3-chloro-5-(cyclopentylmethoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.