CAS 1346691-34-6
:3-Chloro-5-(3,3,3-trifluoropropoxy)pyridazine
Description:
3-Chloro-5-(3,3,3-trifluoropropoxy)pyridazine is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two adjacent nitrogen atoms. The presence of a chlorine atom at the 3-position and a trifluoropropoxy group at the 5-position contributes to its unique chemical properties. This compound is likely to exhibit significant polarity due to the electronegative chlorine and trifluoromethyl groups, which can influence its solubility and reactivity. The trifluoropropoxy moiety may enhance its lipophilicity, potentially affecting its biological activity and interactions with other substances. Additionally, the presence of fluorine atoms often imparts stability and can modify the compound's pharmacokinetic properties. As with many halogenated compounds, it may also exhibit specific environmental and health considerations, necessitating careful handling and assessment of its safety profile. Overall, 3-Chloro-5-(3,3,3-trifluoropropoxy)pyridazine is a compound of interest in various fields, including pharmaceuticals and agrochemicals, due to its distinctive structural features.
Formula:C7H6ClF3N2O
InChI:InChI=1S/C7H6ClF3N2O/c8-6-3-5(4-12-13-6)14-2-1-7(9,10)11/h3-4H,1-2H2
InChI key:InChIKey=HBIHLLUKLCLKNG-UHFFFAOYSA-N
SMILES:O(CCC(F)(F)F)C=1C=C(Cl)N=NC1
Synonyms:- Pyridazine, 3-chloro-5-(3,3,3-trifluoropropoxy)-
- 3-Chloro-5-(3,3,3-trifluoropropoxy)pyridazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
