
CAS 1346691-35-7
:Methyl 2-[(6-chloro-4-pyridazinyl)oxy]acetate
Description:
Methyl 2-[(6-chloro-4-pyridazinyl)oxy]acetate is a chemical compound characterized by its unique structure, which includes a pyridazine ring substituted with a chlorine atom and an ether functional group. This compound typically exhibits properties associated with both ester and aromatic functionalities, contributing to its potential reactivity and solubility in organic solvents. The presence of the chloro substituent can influence its electronic properties, potentially enhancing its reactivity in nucleophilic substitution reactions. Methyl 2-[(6-chloro-4-pyridazinyl)oxy]acetate may also display biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests it could participate in various chemical reactions, including esterification and ether formation. Additionally, the compound's stability and behavior under different conditions, such as temperature and pH, would be essential for applications in synthesis and formulation. Overall, this compound represents a versatile building block in organic chemistry, with potential applications in medicinal chemistry and agrochemicals.
Formula:C7H7ClN2O3
InChI:InChI=1S/C7H7ClN2O3/c1-12-7(11)4-13-5-2-6(8)10-9-3-5/h2-3H,4H2,1H3
InChI key:InChIKey=PKIGUQASUGQUMZ-UHFFFAOYSA-N
SMILES:O(CC(OC)=O)C=1C=C(Cl)N=NC1
Synonyms:- Acetic acid, 2-[(6-chloro-4-pyridazinyl)oxy]-, methyl ester
- Methyl 2-[(6-chloro-4-pyridazinyl)oxy]acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
