CAS 1346691-36-8
:Ethyl 2-[(6-chloro-4-pyridazinyl)oxy]acetate
Description:
Ethyl 2-[(6-chloro-4-pyridazinyl)oxy]acetate is a chemical compound characterized by its unique structure, which includes an ethyl ester functional group and a pyridazine moiety. The presence of the chloro substituent on the pyridazine ring enhances its reactivity and potential biological activity. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, which makes it useful in various chemical applications, including synthesis and as an intermediate in pharmaceutical development. The compound may exhibit specific pharmacological properties due to its structural features, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks. Overall, Ethyl 2-[(6-chloro-4-pyridazinyl)oxy]acetate represents a versatile building block in organic synthesis and drug discovery.
Formula:C8H9ClN2O3
InChI:InChI=1S/C8H9ClN2O3/c1-2-13-8(12)5-14-6-3-7(9)11-10-4-6/h3-4H,2,5H2,1H3
InChI key:InChIKey=ITQOWKCODKBRGY-UHFFFAOYSA-N
SMILES:O(CC(OCC)=O)C=1C=C(Cl)N=NC1
Synonyms:- Acetic acid, 2-[(6-chloro-4-pyridazinyl)oxy]-, ethyl ester
- Ethyl 2-[(6-chloro-4-pyridazinyl)oxy]acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
