CymitQuimica logo

CAS 1346691-40-4

:

2-[(6-Chloro-4-pyridazinyl)oxy]-N,N-dimethylethanamine

Description:
2-[(6-Chloro-4-pyridazinyl)oxy]-N,N-dimethylethanamine, identified by its CAS number 1346691-40-4, is a chemical compound that features a pyridazine ring substituted with a chlorine atom and an ether linkage. This compound is characterized by its amine functional group, specifically a dimethylamino group, which contributes to its basicity and potential reactivity. The presence of the chloro substituent on the pyridazine ring may influence its biological activity and interaction with other molecules. The compound is likely to exhibit moderate solubility in polar solvents due to the presence of the amine and ether functionalities. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where the pyridazine moiety is often associated with various biological activities. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound would need to be assessed through further studies.
Formula:C8H12ClN3O
InChI:InChI=1S/C8H12ClN3O/c1-12(2)3-4-13-7-5-8(9)11-10-6-7/h5-6H,3-4H2,1-2H3
InChI key:InChIKey=NQJNTIBGXUTXNX-UHFFFAOYSA-N
SMILES:O(CCN(C)C)C=1C=C(Cl)N=NC1
Synonyms:
  • 2-[(6-Chloro-4-pyridazinyl)oxy]-N,N-dimethylethanamine
  • Ethanamine, 2-[(6-chloro-4-pyridazinyl)oxy]-N,N-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.