CAS 1346691-44-8
:3-Pyridinemethanamine, 5-(2-fluorophenyl)-
Description:
3-Pyridinemethanamine, 5-(2-fluorophenyl)-, identified by the CAS number 1346691-44-8, is a chemical compound that features a pyridine ring substituted with a methanamine group and a 2-fluorophenyl moiety. This compound is characterized by its aromatic nature due to the presence of the pyridine and phenyl rings, which contribute to its potential biological activity. The fluorine atom in the 2-position of the phenyl group can influence the compound's electronic properties, potentially enhancing its lipophilicity and altering its interaction with biological targets. The presence of the amine group suggests that it may participate in hydrogen bonding, making it a candidate for various chemical reactions and applications in medicinal chemistry. Overall, this compound's unique structure may confer specific pharmacological properties, making it of interest in drug discovery and development. However, detailed studies would be necessary to fully elucidate its behavior and potential applications in various fields.
Formula:C12H11FN2
InChI:InChI=1S/C12H11FN2/c13-12-4-2-1-3-11(12)10-5-9(6-14)7-15-8-10/h1-5,7-8H,6,14H2
InChI key:InChIKey=JKZOFOLTSQQEHX-UHFFFAOYSA-N
SMILES:FC1=C(C=2C=C(CN)C=NC2)C=CC=C1
Synonyms:- 3-Pyridinemethanamine, 5-(2-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
