CAS 1346691-50-6
:Methyl 5-(2-cyanophenyl)-3-pyridinecarboxylate
Description:
Methyl 5-(2-cyanophenyl)-3-pyridinecarboxylate is an organic compound characterized by its complex structure, which includes a pyridine ring and a cyanophenyl group. This compound features a methyl ester functional group, contributing to its reactivity and solubility properties. The presence of the cyano group (-C≡N) enhances its polarity and can influence its interactions in various chemical environments. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. The molecular structure suggests potential applications in organic synthesis, particularly in the development of more complex molecules. Additionally, the compound's stability and reactivity can be influenced by factors such as temperature, solvent, and pH. As with many organic compounds, safety considerations should be taken into account when handling, including proper storage and disposal methods. Overall, Methyl 5-(2-cyanophenyl)-3-pyridinecarboxylate represents a versatile building block in organic chemistry with potential applications in various fields.
Formula:C14H10N2O2
InChI:InChI=1S/C14H10N2O2/c1-18-14(17)12-6-11(8-16-9-12)13-5-3-2-4-10(13)7-15/h2-6,8-9H,1H3
InChI key:InChIKey=WDJQXHXVGPIRKZ-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C=CC=C1)C=2C=C(C(OC)=O)C=NC2
Synonyms:- 3-Pyridinecarboxylic acid, 5-(2-cyanophenyl)-, methyl ester
- Methyl 5-(2-cyanophenyl)-3-pyridinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
