CymitQuimica logo

CAS 1346691-51-7

:

5-(2-Cyanophenyl)-3-pyridinecarboxamide

Description:
5-(2-Cyanophenyl)-3-pyridinecarboxamide, identified by its CAS number 1346691-51-7, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a cyanophenyl group. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential for hydrogen bonding due to the presence of the amide functional group. The presence of the cyano group contributes to its electronic properties, potentially enhancing its reactivity and interaction with other chemical species. Additionally, the pyridine ring can influence the compound's acidity and basicity, making it relevant in various chemical reactions and applications. Such compounds may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to their ability to interact with biological targets. Overall, 5-(2-Cyanophenyl)-3-pyridinecarboxamide represents a versatile structure with potential applications in both research and industry.
Formula:C13H9N3O
InChI:InChI=1S/C13H9N3O/c14-6-9-3-1-2-4-12(9)10-5-11(13(15)17)8-16-7-10/h1-5,7-8H,(H2,15,17)
InChI key:InChIKey=ZDRMBHLXOGQREA-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C=2C=C(C(N)=O)C=NC2)C=CC=C1
Synonyms:
  • 3-Pyridinecarboxamide, 5-(2-cyanophenyl)-
  • 5-(2-Cyanophenyl)-3-pyridinecarboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.