CymitQuimica logo

CAS 1346691-52-8

:

5-(2-Cyanophenyl)-3-pyridinecarbonitrile

Description:
5-(2-Cyanophenyl)-3-pyridinecarbonitrile is a chemical compound characterized by its unique structure, which includes a pyridine ring and a cyanophenyl group. This compound features a pyridine moiety, which is a six-membered aromatic ring containing one nitrogen atom, contributing to its potential basicity and reactivity. The presence of the cyano (-CN) groups enhances its electron-withdrawing properties, making it useful in various chemical reactions and applications. The compound is likely to exhibit moderate solubility in organic solvents due to its aromatic nature, while its polar cyano groups may influence its interactions with other molecules. Additionally, compounds like this one are often investigated for their potential biological activities, including anti-cancer or anti-inflammatory properties, owing to the presence of the pyridine and cyano functionalities. Overall, 5-(2-Cyanophenyl)-3-pyridinecarbonitrile represents a class of compounds that can be valuable in medicinal chemistry and material science.
Formula:C13H7N3
InChI:InChI=1S/C13H7N3/c14-6-10-5-12(9-16-8-10)13-4-2-1-3-11(13)7-15/h1-5,8-9H
InChI key:InChIKey=FOMKWNHQVFJONZ-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C=2C=C(C#N)C=NC2)C=CC=C1
Synonyms:
  • 3-Pyridinecarbonitrile, 5-(2-cyanophenyl)-
  • 5-(2-Cyanophenyl)-3-pyridinecarbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.