CymitQuimica logo

CAS 1346691-53-9

:

2-[5-(Hydroxymethyl)-3-pyridinyl]benzonitrile

Description:
2-[5-(Hydroxymethyl)-3-pyridinyl]benzonitrile, identified by its CAS number 1346691-53-9, is an organic compound characterized by its complex structure, which includes a pyridine ring and a benzonitrile moiety. The presence of the hydroxymethyl group on the pyridine ring contributes to its potential reactivity and solubility in various solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, possibly influencing its pharmacological properties. Additionally, the nitrile functional group can participate in various chemical reactions, such as nucleophilic additions or hydrolysis, which may be relevant in synthetic applications. The compound's characteristics, including its melting point, boiling point, and solubility, would depend on its specific molecular interactions and the environment in which it is studied. Overall, 2-[5-(Hydroxymethyl)-3-pyridinyl]benzonitrile represents a versatile chemical entity with potential applications in research and industry.
Formula:C13H10N2O
InChI:InChI=1S/C13H10N2O/c14-6-11-3-1-2-4-13(11)12-5-10(9-16)7-15-8-12/h1-5,7-8,16H,9H2
InChI key:InChIKey=FIECQRFDEBBALP-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C=2C=C(CO)C=NC2)C=CC=C1
Synonyms:
  • 2-[5-(Hydroxymethyl)-3-pyridinyl]benzonitrile
  • Benzonitrile, 2-[5-(hydroxymethyl)-3-pyridinyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.