
CAS 1346691-54-0
:2-(5-Formyl-3-pyridinyl)benzonitrile
Description:
2-(5-Formyl-3-pyridinyl)benzonitrile, identified by its CAS number 1346691-54-0, is an organic compound characterized by the presence of both a pyridine and a benzonitrile moiety. This compound features a formyl group (-CHO) attached to the pyridine ring, which contributes to its reactivity and potential applications in organic synthesis. The structure includes a nitrile group (-C≡N), which is known for its ability to participate in various chemical reactions, including nucleophilic additions and cycloadditions. The presence of the aromatic rings imparts stability and influences the compound's electronic properties, making it suitable for applications in materials science and medicinal chemistry. Additionally, the compound may exhibit interesting biological activities due to the functional groups present, which can interact with biological targets. Its solubility and reactivity can vary depending on the solvent and conditions, making it a versatile compound for research and development in various chemical fields.
Formula:C13H8N2O
InChI:InChI=1S/C13H8N2O/c14-6-11-3-1-2-4-13(11)12-5-10(9-16)7-15-8-12/h1-5,7-9H
InChI key:InChIKey=RQZIIZOCUWGJQP-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C=2C=C(C=O)C=NC2)C=CC=C1
Synonyms:- Benzonitrile, 2-(5-formyl-3-pyridinyl)-
- 2-(5-Formyl-3-pyridinyl)benzonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
