CymitQuimica logo

CAS 1346691-56-2

:

5-(3-Cyanophenyl)-3-pyridinecarboxamide

Description:
5-(3-Cyanophenyl)-3-pyridinecarboxamide is an organic compound characterized by its unique structural features, which include a pyridine ring and a cyanophenyl group. The presence of the pyridine moiety contributes to its potential as a ligand in coordination chemistry and its utility in medicinal chemistry due to its ability to interact with biological targets. The cyanophenyl substituent introduces a nitrile functional group, which can enhance the compound's polarity and solubility in various solvents. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in drug development. Its molecular structure suggests potential interactions with enzymes or receptors, which could be explored in the context of therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents, making it a subject of interest in synthetic organic chemistry. Overall, 5-(3-Cyanophenyl)-3-pyridinecarboxamide represents a versatile scaffold for further exploration in both academic and industrial research settings.
Formula:C13H9N3O
InChI:InChI=1S/C13H9N3O/c14-6-9-2-1-3-10(4-9)11-5-12(13(15)17)8-16-7-11/h1-5,7-8H,(H2,15,17)
InChI key:InChIKey=MILLXBZKCRSTME-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=CC(=CN=C1)C2=CC(C#N)=CC=C2
Synonyms:
  • 5-(3-Cyanophenyl)-3-pyridinecarboxamide
  • 3-Pyridinecarboxamide, 5-(3-cyanophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.