CAS 1346691-57-3
:5-(3-Cyanophenyl)-3-pyridinecarbonitrile
Description:
5-(3-Cyanophenyl)-3-pyridinecarbonitrile is an organic compound characterized by its complex structure, which includes a pyridine ring and a cyanophenyl group. The presence of the pyridine moiety contributes to its aromaticity and potential for various chemical interactions, while the cyano groups enhance its reactivity and polarity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents due to the presence of the cyano functional group. Its chemical properties suggest potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. The compound may also display interesting electronic properties due to the conjugation between the aromatic systems. Additionally, its synthesis and reactivity can be influenced by the substituents on the aromatic rings, making it a subject of interest in medicinal chemistry and materials science. Safety data should be consulted for handling, as compounds with cyano groups can be toxic or hazardous.
Formula:C13H7N3
InChI:InChI=1S/C13H7N3/c14-6-10-2-1-3-12(4-10)13-5-11(7-15)8-16-9-13/h1-5,8-9H
InChI key:InChIKey=AMOOZAVLEIJTDL-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C(C=CC1)C=2C=C(C#N)C=NC2
Synonyms:- 3-Pyridinecarbonitrile, 5-(3-cyanophenyl)-
- 5-(3-Cyanophenyl)-3-pyridinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
