CymitQuimica logo

CAS 1346691-58-4

:

3-[5-(Aminomethyl)-3-pyridinyl]benzonitrile

Description:
3-[5-(Aminomethyl)-3-pyridinyl]benzonitrile, identified by its CAS number 1346691-58-4, is a chemical compound characterized by its structural features, which include a benzonitrile moiety and a pyridine ring with an aminomethyl substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for various chemical reactions. The presence of the nitrile group suggests it may participate in nucleophilic addition reactions, while the aminomethyl group can engage in hydrogen bonding and may influence the compound's solubility and reactivity. Additionally, the pyridine ring can contribute to the compound's basicity and potential interactions with biological targets, making it of interest in medicinal chemistry. Overall, this compound's unique structure may confer specific pharmacological properties, warranting further investigation for applications in drug development or as a chemical intermediate in synthetic processes.
Formula:C13H11N3
InChI:InChI=1S/C13H11N3/c14-6-10-2-1-3-12(4-10)13-5-11(7-15)8-16-9-13/h1-5,8-9H,7,15H2
InChI key:InChIKey=OSSVNFFADBKPNL-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C(C=CC1)C=2C=C(CN)C=NC2
Synonyms:
  • Benzonitrile, 3-[5-(aminomethyl)-3-pyridinyl]-
  • 3-[5-(Aminomethyl)-3-pyridinyl]benzonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.