CymitQuimica logo

CAS 1346691-59-5

:

5-(4-Cyanophenyl)-3-pyridinecarboxamide

Description:
5-(4-Cyanophenyl)-3-pyridinecarboxamide, identified by its CAS number 1346691-59-5, is a chemical compound characterized by its unique structural features. It consists of a pyridine ring substituted with a carboxamide group and a 4-cyanophenyl moiety. The presence of the cyanophenyl group imparts notable electronic properties, making the compound potentially useful in various applications, including pharmaceuticals and materials science. The pyridine ring contributes to the compound's aromaticity and stability, while the carboxamide functional group enhances its solubility in polar solvents. This compound may exhibit biological activity, which can be attributed to its ability to interact with biological targets, making it of interest in medicinal chemistry. Additionally, its molecular structure suggests potential for hydrogen bonding and other intermolecular interactions, which can influence its reactivity and binding properties. Overall, 5-(4-Cyanophenyl)-3-pyridinecarboxamide is a compound of interest for further research and development in various chemical and biological contexts.
Formula:C13H9N3O
InChI:InChI=1S/C13H9N3O/c14-6-9-1-3-10(4-2-9)11-5-12(13(15)17)8-16-7-11/h1-5,7-8H,(H2,15,17)
InChI key:InChIKey=WFDOSEAIYVEIEW-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=CC(=CN=C1)C2=CC=C(C#N)C=C2
Synonyms:
  • 3-Pyridinecarboxamide, 5-(4-cyanophenyl)-
  • 5-(4-Cyanophenyl)-3-pyridinecarboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.