CAS 1346691-60-8
:5-(4-Cyanophenyl)-3-pyridinecarbonitrile
Description:
5-(4-Cyanophenyl)-3-pyridinecarbonitrile is an organic compound characterized by its complex structure, which includes a pyridine ring and a cyanophenyl group. This compound features a pyridine moiety, a six-membered aromatic ring containing one nitrogen atom, which contributes to its potential basicity and reactivity. The presence of the cyano group (-C≡N) enhances its electron-withdrawing properties, making it a useful building block in various chemical syntheses and applications. The compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent properties. Its unique structure suggests potential applications in pharmaceuticals, agrochemicals, or materials science, particularly in the development of novel compounds with specific biological activities or electronic properties. Additionally, the presence of multiple functional groups may allow for further chemical modifications, expanding its utility in synthetic chemistry. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.
Formula:C13H7N3
InChI:InChI=1S/C13H7N3/c14-6-10-1-3-12(4-2-10)13-5-11(7-15)8-16-9-13/h1-5,8-9H
InChI key:InChIKey=FZHJXZAWMQXFLR-UHFFFAOYSA-N
SMILES:C(#N)C1=CC(=CN=C1)C2=CC=C(C#N)C=C2
Synonyms:- 3-Pyridinecarbonitrile, 5-(4-cyanophenyl)-
- 5-(4-Cyanophenyl)-3-pyridinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
