CAS 1346691-61-9
:4-[5-(Hydroxymethyl)-3-pyridinyl]benzonitrile
Description:
4-[5-(Hydroxymethyl)-3-pyridinyl]benzonitrile, identified by its CAS number 1346691-61-9, is an organic compound characterized by its complex structure that includes a pyridine ring and a benzonitrile moiety. This compound features a hydroxymethyl group attached to the pyridine ring, which can influence its solubility and reactivity. Typically, compounds of this nature exhibit polar characteristics due to the presence of the hydroxymethyl group, which can engage in hydrogen bonding. The nitrile functional group contributes to the compound's potential as a ligand in coordination chemistry and may also impart specific electronic properties. Additionally, the presence of both aromatic and heterocyclic components suggests that this substance may exhibit interesting biological activities, making it a candidate for pharmaceutical research. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity would be influenced by the electronic effects of the substituents on the aromatic rings. Overall, this compound represents a valuable structure in the realm of medicinal chemistry and material science.
Formula:C13H10N2O
InChI:InChI=1S/C13H10N2O/c14-6-10-1-3-12(4-2-10)13-5-11(9-16)7-15-8-13/h1-5,7-8,16H,9H2
InChI key:InChIKey=BBUUHMILNBPTQG-UHFFFAOYSA-N
SMILES:C(O)C1=CC(=CN=C1)C2=CC=C(C#N)C=C2
Synonyms:- 4-[5-(Hydroxymethyl)-3-pyridinyl]benzonitrile
- Benzonitrile, 4-[5-(hydroxymethyl)-3-pyridinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
