CymitQuimica logo

CAS 1346691-63-1

:

5-(2,3-Difluorophenyl)-3-pyridinecarboxamide

Description:
5-(2,3-Difluorophenyl)-3-pyridinecarboxamide is a chemical compound characterized by its specific structural features, which include a pyridine ring and a carboxamide functional group. The presence of the difluorophenyl moiety indicates that the compound has two fluorine atoms substituted on a phenyl ring, which can significantly influence its chemical properties, such as polarity and reactivity. This compound is likely to exhibit moderate to high solubility in polar solvents due to the carboxamide group, which can engage in hydrogen bonding. Additionally, the difluorination may enhance its lipophilicity and biological activity, making it of interest in pharmaceutical research. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of targeted therapies or as a lead compound in drug discovery. Its specific interactions with biological targets would depend on the overall three-dimensional conformation and electronic properties imparted by the difluorophenyl and pyridinecarboxamide functionalities.
Formula:C12H8F2N2O
InChI:InChI=1S/C12H8F2N2O/c13-10-3-1-2-9(11(10)14)7-4-8(12(15)17)6-16-5-7/h1-6H,(H2,15,17)
InChI key:InChIKey=GFWNVOPJSAFWIY-UHFFFAOYSA-N
SMILES:FC1=C(C=2C=C(C(N)=O)C=NC2)C=CC=C1F
Synonyms:
  • 3-Pyridinecarboxamide, 5-(2,3-difluorophenyl)-
  • 5-(2,3-Difluorophenyl)-3-pyridinecarboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.