CAS 1346691-66-4
:Methyl 5-(2,4-difluorophenyl)-3-pyridinecarboxylate
Description:
Methyl 5-(2,4-difluorophenyl)-3-pyridinecarboxylate is an organic compound characterized by its pyridine and difluorophenyl moieties. It features a pyridine ring substituted at the 3-position with a carboxylate group, which is further esterified with a methyl group. The presence of the 2,4-difluorophenyl group introduces two fluorine atoms on the aromatic ring, enhancing the compound's lipophilicity and potentially influencing its biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the pyridine and aromatic systems, which are common in bioactive compounds. Additionally, the fluorine substituents can enhance metabolic stability and bioavailability. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact.
Formula:C13H9F2NO2
InChI:InChI=1S/C13H9F2NO2/c1-18-13(17)9-4-8(6-16-7-9)11-3-2-10(14)5-12(11)15/h2-7H,1H3
InChI key:InChIKey=BZTJGSHWKXFZMA-UHFFFAOYSA-N
SMILES:FC1=C(C=2C=C(C(OC)=O)C=NC2)C=CC(F)=C1
Synonyms:- Methyl 5-(2,4-difluorophenyl)-3-pyridinecarboxylate
- 3-Pyridinecarboxylic acid, 5-(2,4-difluorophenyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
