CAS 1346691-67-5
:5-(2,4-Difluorophenyl)-3-pyridinecarboxamide
Description:
5-(2,4-Difluorophenyl)-3-pyridinecarboxamide is a chemical compound characterized by its specific molecular structure, which includes a pyridine ring and a carboxamide functional group. The presence of the difluorophenyl moiety indicates that the compound has two fluorine atoms substituted on the phenyl ring, which can significantly influence its chemical properties, such as polarity and reactivity. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic rings, which may affect its bioavailability and interaction with biological systems. Additionally, the carboxamide group can participate in hydrogen bonding, enhancing solubility in polar solvents. The compound may also exhibit potential biological activity, making it of interest in pharmaceutical research. Its specific characteristics, including melting point, boiling point, and solubility, would depend on the molecular interactions and the overall stability of the compound. As with many organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.
Formula:C12H8F2N2O
InChI:InChI=1S/C12H8F2N2O/c13-9-1-2-10(11(14)4-9)7-3-8(12(15)17)6-16-5-7/h1-6H,(H2,15,17)
InChI key:InChIKey=BGGWCUFRNZWNPM-UHFFFAOYSA-N
SMILES:FC1=C(C=2C=C(C(N)=O)C=NC2)C=CC(F)=C1
Synonyms:- 5-(2,4-Difluorophenyl)-3-pyridinecarboxamide
- 3-Pyridinecarboxamide, 5-(2,4-difluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
