CAS 1346691-68-6
:5-(2,4-Difluorophenyl)-3-pyridinecarbonitrile
Description:
5-(2,4-Difluorophenyl)-3-pyridinecarbonitrile is a chemical compound characterized by its unique structural features, which include a pyridine ring and a cyano group attached to a phenyl ring that has two fluorine substituents. The presence of the difluorophenyl moiety contributes to its potential reactivity and biological activity, as fluorine atoms can significantly influence the electronic properties of the molecule. This compound is typically classified as an organic heterocyclic compound due to the inclusion of nitrogen in the ring structure. Its applications may span various fields, including pharmaceuticals and agrochemicals, where such compounds are often investigated for their potential as active ingredients or intermediates. The molecular structure suggests that it may exhibit interesting interactions with biological targets, making it a candidate for further research in medicinal chemistry. Additionally, the presence of the cyano group can enhance its polarity and solubility characteristics, which are important for its behavior in different chemical environments.
Formula:C12H6F2N2
InChI:InChI=1S/C12H6F2N2/c13-10-1-2-11(12(14)4-10)9-3-8(5-15)6-16-7-9/h1-4,6-7H
InChI key:InChIKey=SRSFNXMJBZKGCF-UHFFFAOYSA-N
SMILES:FC1=C(C=CC(F)=C1)C=2C=C(C#N)C=NC2
Synonyms:- 5-(2,4-Difluorophenyl)-3-pyridinecarbonitrile
- 3-Pyridinecarbonitrile, 5-(2,4-difluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
