CymitQuimica logo

CAS 1346691-70-0

:

Methyl 5-(3,4-difluorophenyl)-3-pyridinecarboxylate

Description:
Methyl 5-(3,4-difluorophenyl)-3-pyridinecarboxylate is an organic compound characterized by its pyridine and aromatic fluorinated substituents. It features a pyridine ring, which is a six-membered heterocyclic structure containing one nitrogen atom, and a carboxylate functional group, indicating its potential as an ester. The presence of the 3,4-difluorophenyl group introduces two fluorine atoms on the aromatic ring, which can significantly influence the compound's electronic properties, reactivity, and lipophilicity. This compound may exhibit interesting biological activities due to the structural motifs present, making it a candidate for pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the presence of fluorine atoms often enhances metabolic stability and bioavailability. As with many organic compounds, its physical properties such as solubility, melting point, and boiling point would depend on the specific interactions between its functional groups and the surrounding environment.
Formula:C13H9F2NO2
InChI:InChI=1S/C13H9F2NO2/c1-18-13(17)10-4-9(6-16-7-10)8-2-3-11(14)12(15)5-8/h2-7H,1H3
InChI key:InChIKey=WJRAHTAHMVAJLJ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC(=CN=C1)C2=CC(F)=C(F)C=C2
Synonyms:
  • 3-Pyridinecarboxylic acid, 5-(3,4-difluorophenyl)-, methyl ester
  • Methyl 5-(3,4-difluorophenyl)-3-pyridinecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.