CAS 1346691-72-2
:5-(3,4-Difluorophenyl)-3-pyridinemethanol
Description:
5-(3,4-Difluorophenyl)-3-pyridinemethanol is an organic compound characterized by its unique structure, which includes a pyridine ring and a difluorophenyl group. The presence of the hydroxymethyl group (-CH2OH) attached to the pyridine contributes to its potential as a versatile building block in medicinal chemistry. This compound is likely to exhibit polar characteristics due to the hydroxyl group, which can engage in hydrogen bonding, influencing its solubility and reactivity. The difluorophenyl moiety may enhance lipophilicity and biological activity, making it of interest in drug design. Additionally, the fluorine atoms can impart unique electronic properties, potentially affecting the compound's interaction with biological targets. As with many pyridine derivatives, this compound may exhibit various biological activities, including antimicrobial or anti-inflammatory properties, although specific biological data would depend on empirical studies. Overall, 5-(3,4-Difluorophenyl)-3-pyridinemethanol represents a compound with significant potential in pharmaceutical applications, warranting further investigation into its properties and uses.
Formula:C12H9F2NO
InChI:InChI=1S/C12H9F2NO/c13-11-2-1-9(4-12(11)14)10-3-8(7-16)5-15-6-10/h1-6,16H,7H2
InChI key:InChIKey=KOLHOHYNBLKSLQ-UHFFFAOYSA-N
SMILES:FC=1C=C(C=CC1F)C=2C=C(CO)C=NC2
Synonyms:- 3-Pyridinemethanol, 5-(3,4-difluorophenyl)-
- 5-(3,4-Difluorophenyl)-3-pyridinemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
