CAS 1346691-74-4
:5-(3,4-Difluorophenyl)-3-pyridinemethanamine
Description:
5-(3,4-Difluorophenyl)-3-pyridinemethanamine is a chemical compound characterized by its unique structure, which includes a pyridine ring and a difluorophenyl group. This compound features a pyridinemethanamine backbone, indicating the presence of an amine functional group attached to a methylene bridge connecting to the pyridine. The difluorophenyl substituent suggests that the compound has two fluorine atoms located on the aromatic ring, which can significantly influence its electronic properties and reactivity. Such substitutions often enhance lipophilicity and can affect the compound's biological activity. The presence of the amine group may also contribute to hydrogen bonding capabilities, making it potentially useful in various chemical reactions or as a pharmaceutical intermediate. Overall, the characteristics of this compound, including its molecular structure and functional groups, suggest potential applications in medicinal chemistry, particularly in the development of targeted therapies or as a building block for more complex molecules.
Formula:C12H10F2N2
InChI:InChI=1S/C12H10F2N2/c13-11-2-1-9(4-12(11)14)10-3-8(5-15)6-16-7-10/h1-4,6-7H,5,15H2
InChI key:InChIKey=PQFPFBPLEWYQCE-UHFFFAOYSA-N
SMILES:FC=1C=C(C=CC1F)C=2C=C(CN)C=NC2
Synonyms:- 3-Pyridinemethanamine, 5-(3,4-difluorophenyl)-
- 5-(3,4-Difluorophenyl)-3-pyridinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
